Difference between revisions of "CPD0-1074"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * smiles: ** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2)) * inchi-key: ** meymblgokydglz-uh...") |
(Created page with "Category:metabolite == Metabolite CPD0-1074 == * common-name: ** aminomethylphosphonate * smiles: ** c(p([o-])(=o)[o-])[n+] * inchi-key: ** mgrvrxrgtboshw-uhfffaoysa-m * m...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-1074 == |
* common-name: | * common-name: | ||
− | ** | + | ** aminomethylphosphonate |
* smiles: | * smiles: | ||
− | ** c([ | + | ** c(p([o-])(=o)[o-])[n+] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mgrvrxrgtboshw-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 110.029 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17951]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=aminomethylphosphonate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mgrvrxrgtboshw-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=110.029}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD0-1074
- common-name:
- aminomethylphosphonate
- smiles:
- c(p([o-])(=o)[o-])[n+]
- inchi-key:
- mgrvrxrgtboshw-uhfffaoysa-m
- molecular-weight:
- 110.029