Difference between revisions of "Red-NADPH-Hemoprotein-Reductases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inch...") |
(Created page with "Category:metabolite == Metabolite Red-NADPH-Hemoprotein-Reductases == * common-name: ** a reduced [nadph-hemoprotein reductase] == Reaction(s) known to consume the compoun...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Red-NADPH-Hemoprotein-Reductases == |
* common-name: | * common-name: | ||
− | ** | + | ** a reduced [nadph-hemoprotein reductase] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] |
− | * [[RXN- | + | * [[RXN-11056]] |
+ | * [[RXN-11057]] | ||
+ | * [[RXN-13064]] | ||
+ | * [[RXN-17625]] | ||
+ | * [[RXN-17627]] | ||
+ | * [[RXN-8630]] | ||
+ | * [[RXN-8872]] | ||
+ | * [[RXN66-146]] | ||
+ | * [[RXN66-161]] | ||
+ | * [[RXN66-163]] | ||
+ | * [[RXN66-169]] | ||
+ | * [[RXN66-181]] | ||
+ | * [[SQUALENE-MONOOXYGENASE-RXN]] | ||
+ | * [[UNSPECIFIC-MONOOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17627]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a reduced [nadph-hemoprotein reductase]}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Red-NADPH-Hemoprotein-Reductases
- common-name:
- a reduced [nadph-hemoprotein reductase]
Reaction(s) known to consume the compound
- HEME-OXYGENASE-DECYCLIZING-RXN
- RXN-11056
- RXN-11057
- RXN-13064
- RXN-17625
- RXN-17627
- RXN-8630
- RXN-8872
- RXN66-146
- RXN66-161
- RXN66-163
- RXN66-169
- RXN66-181
- SQUALENE-MONOOXYGENASE-RXN
- UNSPECIFIC-MONOOXYGENASE-RXN
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a reduced [nadph-hemoprotein reductase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.