Difference between revisions of "PWY-6894"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-5-methyluracil1939 23S-rRNA-5-methyluracil1939] == * common-name: ** a 5-methyluracil1...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-824 CPD-824] == * common-name: ** 5-guanidino-2-oxopentanoate * smiles: ** c(c(cccnc(=[n+])...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-824 CPD-824] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-guanidino-2-oxopentanoate |
| + | * smiles: | ||
| + | ** c(c(cccnc(=[n+])n)=o)(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** arbhxjxxvvhmet-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 173.171 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ARG-OXIDATION-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-guanidino-2-oxopentanoate}} |
| + | {{#set: inchi-key=inchikey=arbhxjxxvvhmet-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=173.171}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-824
- common-name:
- 5-guanidino-2-oxopentanoate
- smiles:
- c(c(cccnc(=[n+])n)=o)(=o)[o-]
- inchi-key:
- arbhxjxxvvhmet-uhfffaoysa-n
- molecular-weight:
- 173.171
