Difference between revisions of "HYDROXY-METHYL-BUTENYL-DIP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cyclic-2-3-Ribonucleoside-Monophosphates == * common-name: ** a ribonucleoside 2',3'-cyclic phosphate == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite HYDROXY-METHYL-BUTENYL-DIP == * common-name: ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate * smiles: ** cc(co)=ccop(op([o-])(=o)[o-]...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HYDROXY-METHYL-BUTENYL-DIP == |
* common-name: | * common-name: | ||
− | ** | + | ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate |
+ | * smiles: | ||
+ | ** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** mdsizrkjvdmqoq-gorduthdsa-k | ||
+ | * molecular-weight: | ||
+ | ** 259.069 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HDS]] |
+ | * [[IDS1]] | ||
+ | * [[IDS2]] | ||
+ | * [[ISPH2-RXN]] | ||
+ | * [[RXN0-884]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[HDS]] | ||
+ | * [[RXN-15878]] | ||
+ | * [[RXN0-882]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}} |
+ | {{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}} | ||
+ | {{#set: molecular-weight=259.069}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite HYDROXY-METHYL-BUTENYL-DIP
- common-name:
- (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
- smiles:
- cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
- inchi-key:
- mdsizrkjvdmqoq-gorduthdsa-k
- molecular-weight:
- 259.069