Difference between revisions of "PWY-6518"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE_ALDEHYDE BETAINE_ALDEHYDE] == * common-name: ** betaine aldehyde * smiles: ** c[n+](c)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE_ALDEHYDE BETAINE_ALDEHYDE] ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
+
** betaine aldehyde
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
+
** c[n+](c)(c[ch]=o)c
 
* inchi-key:
 
* inchi-key:
** yyuzysvpfvoylb-rguwmiccsa-j
+
** sxknccspzdcrfd-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 983.813
+
** 102.156
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10707]]
+
* [[BADH-RXN]]
 +
* [[CHD-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10700]]
+
* [[BADH-RXN]]
 +
* [[CHD-RXN]]
 +
* [[RXN0-7230]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa}}
+
{{#set: common-name=betaine aldehyde}}
{{#set: inchi-key=inchikey=yyuzysvpfvoylb-rguwmiccsa-j}}
+
{{#set: inchi-key=inchikey=sxknccspzdcrfd-uhfffaoysa-n}}
{{#set: molecular-weight=983.813}}
+
{{#set: molecular-weight=102.156}}

Revision as of 14:19, 26 August 2019

Metabolite BETAINE_ALDEHYDE

  • common-name:
    • betaine aldehyde
  • smiles:
    • c[n+](c)(c[ch]=o)c
  • inchi-key:
    • sxknccspzdcrfd-uhfffaoysa-n
  • molecular-weight:
    • 102.156

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality