Difference between revisions of "Sterol-3-beta-D-glucosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) * inchi-key:...")
(Created page with "Category:metabolite == Metabolite Sterol-3-beta-D-glucosides == * common-name: ** a sterol 3-β-d-glucoside == Reaction(s) known to consume the compound == == Reaction...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RIBOFLAVIN ==
+
== Metabolite Sterol-3-beta-D-glucosides ==
 
* common-name:
 
* common-name:
** riboflavin
+
** a sterol 3-β-d-glucoside
* smiles:
 
** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3)))
 
* inchi-key:
 
** aunganrzjhbgpy-scrdcrapsa-m
 
* molecular-weight:
 
** 375.36
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARPT]]
 
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
 
* [[RIBOFLAVINKIN-RXN]]
 
* [[RXN-12445]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RIBOFLAVIN-SYN-RXN]]
+
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
* [[RXN0-5187]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=riboflavin}}
+
{{#set: common-name=a sterol 3-β-d-glucoside}}
{{#set: inchi-key=inchikey=aunganrzjhbgpy-scrdcrapsa-m}}
 
{{#set: molecular-weight=375.36}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Sterol-3-beta-D-glucosides

  • common-name:
    • a sterol 3-β-d-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality