Difference between revisions of "Sterol-3-beta-D-glucosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7064 == * common-name: ** primary fluorescent chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2...")
(Created page with "Category:metabolite == Metabolite Sterol-3-beta-D-glucosides == * common-name: ** a sterol 3-β-d-glucoside == Reaction(s) known to consume the compound == == Reaction...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7064 ==
+
== Metabolite Sterol-3-beta-D-glucosides ==
 
* common-name:
 
* common-name:
** primary fluorescent chlorophyll catabolite
+
** a sterol 3-β-d-glucoside
* smiles:
 
** ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)cc3(c(c)=c(c=c)c(=o)n3)))c(n4)=5)))c=o)
 
* inchi-key:
 
** vhqsfnuihpntmw-lryvnugjsa-m
 
* molecular-weight:
 
** 626.708
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7741]]
+
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=primary fluorescent chlorophyll catabolite}}
+
{{#set: common-name=a sterol 3-β-d-glucoside}}
{{#set: inchi-key=inchikey=vhqsfnuihpntmw-lryvnugjsa-m}}
 
{{#set: molecular-weight=626.708}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Sterol-3-beta-D-glucosides

  • common-name:
    • a sterol 3-β-d-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality