Difference between revisions of "CPD-7105"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GlcA-GlcNAc-GlcA-Gal-Gal-Xyl-Protein == * common-name: ** a [protein]-3-o-(β-d-glca-(1→3)-α-d-glcnac-(1→4)-β-d-...") |
(Created page with "Category:metabolite == Metabolite CPD-7105 == * common-name: ** deoxyhumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c * inchi-key: ** nqybqbzoh...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7105 == |
* common-name: | * common-name: | ||
− | ** | + | ** deoxyhumulone |
+ | * smiles: | ||
+ | ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c | ||
+ | * inchi-key: | ||
+ | ** nqybqbzohcaccr-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 345.458 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-7810]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=deoxyhumulone}} |
+ | {{#set: inchi-key=inchikey=nqybqbzohcaccr-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=345.458}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7105
- common-name:
- deoxyhumulone
- smiles:
- cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c
- inchi-key:
- nqybqbzohcaccr-uhfffaoysa-m
- molecular-weight:
- 345.458