Difference between revisions of "CPD-804"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03315 == * transcription-direction: ** negative * right-end-position: ** 376824 * left-end-position: ** 354540 * centisome-position: ** 67.37269...")
(Created page with "Category:metabolite == Metabolite CPD-804 == * common-name: ** (4s)-4-hydroxy-2-oxoheptanedioate * smiles: ** c(ccc(o)cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hnoajoyerzts...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03315 ==
+
== Metabolite CPD-804 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (4s)-4-hydroxy-2-oxoheptanedioate
−
* right-end-position:
+
* smiles:
−
** 376824
+
** c(ccc(o)cc(c([o-])=o)=o)([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 354540
+
** hnoajoyerztsnk-bypyzucnsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 67.37269   
+
** 188.137
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[1.1.3.37-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(4s)-4-hydroxy-2-oxoheptanedioate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hnoajoyerztsnk-bypyzucnsa-l}}
−
* [[L-GULONOLACTONE-OXIDASE-RXN]]
+
{{#set: molecular-weight=188.137}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-13689]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY3O-6]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY3DJ-35471]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6387]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7953]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-6386]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY0-1261]]
 
−
** '''3''' reactions found over '''12''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=376824}}
 
−
{{#set: left-end-position=354540}}
 
−
{{#set: centisome-position=67.37269    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-804

  • common-name:
    • (4s)-4-hydroxy-2-oxoheptanedioate
  • smiles:
    • c(ccc(o)cc(c([o-])=o)=o)([o-])=o
  • inchi-key:
    • hnoajoyerztsnk-bypyzucnsa-l
  • molecular-weight:
    • 188.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-804&oldid=138425"