Difference between revisions of "CPD-804"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SUC == * common-name: ** succinate * smiles: ** c(c([o-])=o)cc([o-])=o * inchi-key: ** kdyfgrwqoybrfd-uhfffaoysa-l * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite CPD-804 == * common-name: ** (4s)-4-hydroxy-2-oxoheptanedioate * smiles: ** c(ccc(o)cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hnoajoyerzts...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SUC ==
+
== Metabolite CPD-804 ==
 
* common-name:
 
* common-name:
** succinate
+
** (4s)-4-hydroxy-2-oxoheptanedioate
 
* smiles:
 
* smiles:
** c(c([o-])=o)cc([o-])=o
+
** c(ccc(o)cc(c([o-])=o)=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** kdyfgrwqoybrfd-uhfffaoysa-l
+
** hnoajoyerztsnk-bypyzucnsa-l
 
* molecular-weight:
 
* molecular-weight:
** 116.073
+
** 188.137
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FUMARATE-REDUCTASE-NADH-RXN]]
+
* [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]]
* [[ISOCIT-CLEAV-RXN]]
 
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[RXN-14971]]
 
* [[RXN-15378]]
 
* [[RXN-17811]]
 
* [[RXN-9384]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
* [[SUCDHm]]
 
* [[SUCFUMtmr]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[1.14.11.1-RXN]]
 
* [[1.14.11.18-RXN]]
 
* [[1.14.11.2-RXN]]
 
* [[FUMARATE-REDUCTASE-NADH-RXN]]
 
* [[ISOCIT-CLEAV-RXN]]
 
* [[METBALT-RXN]]
 
* [[MHPCHYDROL-RXN]]
 
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
 
* [[RXN-113]]
 
* [[RXN-11320]]
 
* [[RXN-11321]]
 
* [[RXN-115]]
 
* [[RXN-12353]]
 
* [[RXN-13186]]
 
* [[RXN-171]]
 
* [[RXN-17811]]
 
* [[RXN-527]]
 
* [[RXN-602]]
 
* [[RXN-6550]]
 
* [[RXN-7648]]
 
* [[RXN-7775]]
 
* [[RXN-7922]]
 
* [[RXN-8450]]
 
* [[RXN-8660]]
 
* [[RXN-8661]]
 
* [[RXN-9384]]
 
* [[RXN-9772]]
 
* [[RXN0-5293]]
 
* [[RXN0-7090]]
 
* [[RXN0-984]]
 
* [[RXN0-985]]
 
* [[RXN0-986]]
 
* [[RXN1F-162]]
 
* [[RXN1F-163]]
 
* [[RXN1F-165]]
 
* [[RXN1F-167]]
 
* [[RXN1F-168]]
 
* [[RXN1F-93]]
 
* [[RXN490-3641]]
 
* [[RXN66-470]]
 
* [[SSNOm]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 
* [[SUCCSEMIALDDEHYDROG-RXN]]
 
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
* [[SUCFUMtmr]]
 
* [[SUCHMSSELCYSL]]
 
* [[SUCHMSSELCYSLh]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=succinate}}
+
{{#set: common-name=(4s)-4-hydroxy-2-oxoheptanedioate}}
{{#set: inchi-key=inchikey=kdyfgrwqoybrfd-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=hnoajoyerztsnk-bypyzucnsa-l}}
{{#set: molecular-weight=116.073}}
+
{{#set: molecular-weight=188.137}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-804

  • common-name:
    • (4s)-4-hydroxy-2-oxoheptanedioate
  • smiles:
    • c(ccc(o)cc(c([o-])=o)=o)([o-])=o
  • inchi-key:
    • hnoajoyerztsnk-bypyzucnsa-l
  • molecular-weight:
    • 188.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality