Difference between revisions of "DIHYDROPTERIN-CH2OH-PP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14736 == * common-name: ** l-kynurenine * smiles: ** c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1) * inchi-key: ** ygpsjzoedvaxab-qmmmgpob...") |
(Created page with "Category:metabolite == Metabolite DIHYDROPTERIN-CH2OH-PP == * common-name: ** (7,8-dihydropterin-6-yl)methyl diphosphate * smiles: ** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=n...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROPTERIN-CH2OH-PP == |
* common-name: | * common-name: | ||
| − | ** | + | ** (7,8-dihydropterin-6-yl)methyl diphosphate |
* smiles: | * smiles: | ||
| − | ** c(=o)([o-]) | + | ** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fcqgjglsowzzon-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 352.116 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[H2PTEROATESYNTH-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[H2PTERIDINEPYROPHOSPHOKIN-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(7,8-dihydropterin-6-yl)methyl diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fcqgjglsowzzon-uhfffaoysa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=352.116}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DIHYDROPTERIN-CH2OH-PP
- common-name:
- (7,8-dihydropterin-6-yl)methyl diphosphate
- smiles:
- c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
- inchi-key:
- fcqgjglsowzzon-uhfffaoysa-k
- molecular-weight:
- 352.116
