Difference between revisions of "DIHYDROPTERIN-CH2OH-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite METHYLBUT-CPD == * common-name: ** 2-methylbutanal * smiles: ** ccc(c)[ch]=o * inchi-key: ** bygqbdhughbgmd-uhfffaoysa-n * molecular-weig...")
(Created page with "Category:metabolite == Metabolite DIHYDROPTERIN-CH2OH-PP == * common-name: ** (7,8-dihydropterin-6-yl)methyl diphosphate * smiles: ** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=n...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite METHYLBUT-CPD ==
+
== Metabolite DIHYDROPTERIN-CH2OH-PP ==
 
* common-name:
 
* common-name:
** 2-methylbutanal
+
** (7,8-dihydropterin-6-yl)methyl diphosphate
 
* smiles:
 
* smiles:
** ccc(c)[ch]=o
+
** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
 
* inchi-key:
 
* inchi-key:
** bygqbdhughbgmd-uhfffaoysa-n
+
** fcqgjglsowzzon-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
** 86.133
+
** 352.116
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7694]]
+
* [[H2PTEROATESYNTH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methylbutanal}}
+
{{#set: common-name=(7,8-dihydropterin-6-yl)methyl diphosphate}}
{{#set: inchi-key=inchikey=bygqbdhughbgmd-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=fcqgjglsowzzon-uhfffaoysa-k}}
{{#set: molecular-weight=86.133}}
+
{{#set: molecular-weight=352.116}}

Latest revision as of 11:15, 18 March 2021

Metabolite DIHYDROPTERIN-CH2OH-PP

  • common-name:
    • (7,8-dihydropterin-6-yl)methyl diphosphate
  • smiles:
    • c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
  • inchi-key:
    • fcqgjglsowzzon-uhfffaoysa-k
  • molecular-weight:
    • 352.116

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality