Difference between revisions of "DIHYDROPTERIN-CH2OH-PP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05429 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ACID-PHOSPHATASE-RXN *...") |
(Created page with "Category:metabolite == Metabolite DIHYDROPTERIN-CH2OH-PP == * common-name: ** (7,8-dihydropterin-6-yl)methyl diphosphate * smiles: ** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=n...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DIHYDROPTERIN-CH2OH-PP == |
| − | + | * common-name: | |
| − | * [[ | + | ** (7,8-dihydropterin-6-yl)methyl diphosphate |
| − | == | + | * smiles: |
| − | * | + | ** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2)) |
| − | + | * inchi-key: | |
| − | ** | + | ** fcqgjglsowzzon-uhfffaoysa-k |
| − | * | + | * molecular-weight: |
| − | + | ** 352.116 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | == | + | * [[H2PTEROATESYNTH-RXN]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[H2PTERIDINEPYROPHOSPHOKIN-RXN]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=(7,8-dihydropterin-6-yl)methyl diphosphate}} | |
| − | + | {{#set: inchi-key=inchikey=fcqgjglsowzzon-uhfffaoysa-k}} | |
| − | + | {{#set: molecular-weight=352.116}} | |
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DIHYDROPTERIN-CH2OH-PP
- common-name:
- (7,8-dihydropterin-6-yl)methyl diphosphate
- smiles:
- c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
- inchi-key:
- fcqgjglsowzzon-uhfffaoysa-k
- molecular-weight:
- 352.116
