Difference between revisions of "DIHYDROPTERIN-CH2OH-PP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-Phosphoserines == * common-name: ** a [protein] l-serine phosphate == Reaction(s) known to consume the compound == * 2.7.12.1-R...") |
(Created page with "Category:metabolite == Metabolite DIHYDROPTERIN-CH2OH-PP == * common-name: ** (7,8-dihydropterin-6-yl)methyl diphosphate * smiles: ** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=n...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROPTERIN-CH2OH-PP == |
* common-name: | * common-name: | ||
| − | ** | + | ** (7,8-dihydropterin-6-yl)methyl diphosphate |
| + | * smiles: | ||
| + | ** c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2)) | ||
| + | * inchi-key: | ||
| + | ** fcqgjglsowzzon-uhfffaoysa-k | ||
| + | * molecular-weight: | ||
| + | ** 352.116 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[H2PTEROATESYNTH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[H2PTERIDINEPYROPHOSPHOKIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(7,8-dihydropterin-6-yl)methyl diphosphate}} |
| + | {{#set: inchi-key=inchikey=fcqgjglsowzzon-uhfffaoysa-k}} | ||
| + | {{#set: molecular-weight=352.116}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DIHYDROPTERIN-CH2OH-PP
- common-name:
- (7,8-dihydropterin-6-yl)methyl diphosphate
- smiles:
- c2(c(cop(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
- inchi-key:
- fcqgjglsowzzon-uhfffaoysa-k
- molecular-weight:
- 352.116
