Difference between revisions of "Ubiquitin-activating-protein-E1-L-cys"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == * common-name: ** d-myo-inositol (1,3,4)-trisphosphate * smiles: ** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)(...")
(Created page with "Category:metabolite == Metabolite Ubiquitin-activating-protein-E1-L-cys == * common-name: ** an [e1 ubiquitin-activating enzyme]-l-cysteine == Reaction(s) known to consume...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INOSITOL-1-3-4-TRIPHOSPHATE ==
+
== Metabolite Ubiquitin-activating-protein-E1-L-cys ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4)-trisphosphate
+
** an [e1 ubiquitin-activating enzyme]-l-cysteine
* smiles:
 
** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
 
* inchi-key:
 
** mmwciqzxvozegg-mlqgymepsa-h
 
* molecular-weight:
 
** 414.049
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.133-RXN]]
+
* [[RXN-15565]]
* [[2.7.1.139-RXN]]
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
* [[RXN-10939]]
 
* [[RXN-10959]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8730]]
+
* [[RXN-15556]]
 +
* [[RXN-15563]]
 +
* [[RXN-15565]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}}
+
{{#set: common-name=an [e1 ubiquitin-activating enzyme]-l-cysteine}}
{{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}}
 
{{#set: molecular-weight=414.049}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Ubiquitin-activating-protein-E1-L-cys

  • common-name:
    • an [e1 ubiquitin-activating enzyme]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [e1 ubiquitin-activating enzyme]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.