Difference between revisions of "CPD-18076"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi...") |
(Created page with "Category:metabolite == Metabolite CPD-18076 == * common-name: ** α-d-glc-(1→2)-α-d-glc-(1→3)-α-d-glc-(1→3)-α-d-man-(1→2)-&alpha...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-18076 == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-glc-(1→2)-α-d-glc-(1→3)-α-d-glc-(1→3)-α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[2.4.1.119-RXN]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-5472]] | |
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-glc-(1→2)-α-d-glc-(1→3)-α-d-glc-(1→3)-α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-18076
- common-name:
- α-d-glc-(1→2)-α-d-glc-(1→3)-α-d-glc-(1→3)-α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "α-d-glc-(1→2)-α-d-glc-(1→3)-α-d-glc-(1→3)-α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.