Difference between revisions of "CPD-14115"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-ALANINE == * common-name: ** d-alanine * smiles: ** cc([n+])c([o-])=o * inchi-key: ** qnaybmklocpygj-uwtatzphsa-n * molecular-weight: *...") |
(Created page with "Category:metabolite == Metabolite CPD-14115 == * common-name: ** (s)-equol * smiles: ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) * inchi-key: ** adfcqwzhkcxpaj-gfccveg...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14115 == |
* common-name: | * common-name: | ||
− | ** | + | ** (s)-equol |
* smiles: | * smiles: | ||
− | ** cc( | + | ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** adfcqwzhkcxpaj-gfccvegcsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 242.274 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-15589]] | |
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15589]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-equol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=adfcqwzhkcxpaj-gfccvegcsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=242.274}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-14115
- common-name:
- (s)-equol
- smiles:
- c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o)
- inchi-key:
- adfcqwzhkcxpaj-gfccvegcsa-n
- molecular-weight:
- 242.274