Difference between revisions of "CPD0-2105"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TREHALOSE-6P == * common-name: ** α,α-trehalose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-]...") |
(Created page with "Category:metabolite == Metabolite CPD0-2105 == * common-name: ** 3-oxododecanoyl-coa * smiles: ** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2105 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxododecanoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hqanbzhvwidnqz-gmhmeamdsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 959.791 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HACD5]] |
+ | * [[HACD5h]] | ||
+ | * [[HACD5m]] | ||
+ | * [[RXN-14274]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[HACD5]] |
− | * [[ | + | * [[HACD5h]] |
− | * [[ | + | * [[HACD5m]] |
+ | * [[RXN-14274]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxododecanoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hqanbzhvwidnqz-gmhmeamdsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=959.791}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD0-2105
- common-name:
- 3-oxododecanoyl-coa
- smiles:
- cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- hqanbzhvwidnqz-gmhmeamdsa-j
- molecular-weight:
- 959.791