Difference between revisions of "L-GULONATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00968 == * transcription-direction: ** negative * right-end-position: ** 88902 * left-end-position: ** 79931 * centisome-position: ** 50.294476...") |
(Created page with "Category:metabolite == Metabolite L-GULONATE == * common-name: ** l-gulonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-qtbdoelssa-m * molec...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-GULONATE == |
− | * | + | * common-name: |
− | ** | + | ** l-gulonate |
− | * | + | * smiles: |
− | ** | + | ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** rghnjxzeokukbd-qtbdoelssa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 195.149 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[GLUCURONATE-REDUCTASE-RXN]] |
− | * [[RXN | + | * [[RXN-8783]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=l-gulonate}} | |
− | + | {{#set: inchi-key=inchikey=rghnjxzeokukbd-qtbdoelssa-m}} | |
− | + | {{#set: molecular-weight=195.149}} | |
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite L-GULONATE
- common-name:
- l-gulonate
- smiles:
- c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- rghnjxzeokukbd-qtbdoelssa-m
- molecular-weight:
- 195.149