Difference between revisions of "CPD0-1422"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-ACETO-ACETYL-COA == * common-name: ** 2-methylacetoacetyl-coa * smiles: ** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(...")
(Created page with "Category:metabolite == Metabolite CPD0-1422 == * common-name: ** dipalmitoyl phosphatidate * smiles: ** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccc)=o * i...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-ACETO-ACETYL-COA ==
+
== Metabolite CPD0-1422 ==
 
* common-name:
 
* common-name:
** 2-methylacetoacetyl-coa
+
** dipalmitoyl phosphatidate
 
* smiles:
 
* smiles:
** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c
+
** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccc)=o
 
* inchi-key:
 
* inchi-key:
** nhnodhrscralbf-nqnbqjknsa-j
+
** porpenfltbbhsg-mgbgtmovsa-l
 
* molecular-weight:
 
* molecular-weight:
** 861.604
+
** 646.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.178-RXN]]
+
* [[PHOSPHATIDATE-PHOSPHATASE-RXN-CPD0-1422/WATER//CPD66-34/Pi.29.]]
* [[ACCAT]]
 
* [[HMNOS]]
 
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.178-RXN]]
+
* [[RXN0-6705]]
* [[HMNOS]]
 
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methylacetoacetyl-coa}}
+
{{#set: common-name=dipalmitoyl phosphatidate}}
{{#set: inchi-key=inchikey=nhnodhrscralbf-nqnbqjknsa-j}}
+
{{#set: inchi-key=inchikey=porpenfltbbhsg-mgbgtmovsa-l}}
{{#set: molecular-weight=861.604}}
+
{{#set: molecular-weight=646.883}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD0-1422

  • common-name:
    • dipalmitoyl phosphatidate
  • smiles:
    • cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccc)=o
  • inchi-key:
    • porpenfltbbhsg-mgbgtmovsa-l
  • molecular-weight:
    • 646.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality