Difference between revisions of "CPD0-1422"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14927 == * common-name: ** phytenate * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-] * inchi-key: ** wdwbnnbrpveeod-pfxvradusa-m *...") |
(Created page with "Category:metabolite == Metabolite CPD0-1422 == * common-name: ** dipalmitoyl phosphatidate * smiles: ** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccc)=o * i...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-1422 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dipalmitoyl phosphatidate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccc)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** porpenfltbbhsg-mgbgtmovsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 646.883 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PHOSPHATIDATE-PHOSPHATASE-RXN-CPD0-1422/WATER//CPD66-34/Pi.29.]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-6705]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dipalmitoyl phosphatidate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=porpenfltbbhsg-mgbgtmovsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=646.883}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD0-1422
- common-name:
- dipalmitoyl phosphatidate
- smiles:
- cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccc)=o
- inchi-key:
- porpenfltbbhsg-mgbgtmovsa-l
- molecular-weight:
- 646.883
