Difference between revisions of "Very-Long-Chain-Trans-23-Dehydroacyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCEROL-P == * common-name: ** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o...")
(Created page with "Category:metabolite == Metabolite Very-Long-Chain-Trans-23-Dehydroacyl-CoA == * common-name: ** a very-long-chain trans-2,3-dehydroacyl-coa == Reaction(s) known to consume...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INDOLE-3-GLYCEROL-P ==
+
== Metabolite Very-Long-Chain-Trans-23-Dehydroacyl-CoA ==
 
* common-name:
 
* common-name:
** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate
+
** a very-long-chain trans-2,3-dehydroacyl-coa
* smiles:
 
** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o)
 
* inchi-key:
 
** nqeqtypjsiephw-mnovxskesa-l
 
* molecular-weight:
 
** 285.193
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-2381]]
 
* [[TRYPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[IGPSYN-RXN]]
+
* [[RXN-11750]]
* [[RXN0-2381]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate}}
+
{{#set: common-name=a very-long-chain trans-2,3-dehydroacyl-coa}}
{{#set: inchi-key=inchikey=nqeqtypjsiephw-mnovxskesa-l}}
 
{{#set: molecular-weight=285.193}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Very-Long-Chain-Trans-23-Dehydroacyl-CoA

  • common-name:
    • a very-long-chain trans-2,3-dehydroacyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality