Difference between revisions of "D-ALA-D-ALA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-Oxo-Delta-4-Steroids == * common-name: ** a 3-oxo-δ4-steroid == Reaction(s) known to consume the compound == * 1.3.99.5-RXN *...")
(Created page with "Category:metabolite == Metabolite D-ALA-D-ALA == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c)c([o-])=o * inchi-key: ** defjqiddeaulhb-qwwzwvqmsa-n...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-Oxo-Delta-4-Steroids ==
+
== Metabolite D-ALA-D-ALA ==
 
* common-name:
 
* common-name:
** a 3-oxo-δ4-steroid
+
** d-alanyl-d-alanine
 +
* smiles:
 +
** cc([n+])c(=o)nc(c)c([o-])=o
 +
* inchi-key:
 +
** defjqiddeaulhb-qwwzwvqmsa-n
 +
* molecular-weight:
 +
** 160.172
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.99.5-RXN]]
 
* [[RXN-13682]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13682]]
+
* [[DALADALALIG-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxo-δ4-steroid}}
+
{{#set: common-name=d-alanyl-d-alanine}}
 +
{{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}}
 +
{{#set: molecular-weight=160.172}}

Latest revision as of 11:15, 18 March 2021

Metabolite D-ALA-D-ALA

  • common-name:
    • d-alanyl-d-alanine
  • smiles:
    • cc([n+])c(=o)nc(c)c([o-])=o
  • inchi-key:
    • defjqiddeaulhb-qwwzwvqmsa-n
  • molecular-weight:
    • 160.172

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality