Difference between revisions of "D-ALA-D-ALA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == * common-name: ** (13s)-hpode * smiles: ** cccccc(c=cc=ccccccccc(=o)[o-])oo * inchi-key: ** jdsrhv...")
(Created page with "Category:metabolite == Metabolite D-ALA-D-ALA == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c)c([o-])=o * inchi-key: ** defjqiddeaulhb-qwwzwvqmsa-n...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE ==
+
== Metabolite D-ALA-D-ALA ==
 
* common-name:
 
* common-name:
** (13s)-hpode
+
** d-alanyl-d-alanine
 
* smiles:
 
* smiles:
** cccccc(c=cc=ccccccccc(=o)[o-])oo
+
** cc([n+])c(=o)nc(c)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** jdsrhvwsamtssn-irqzeampsa-m
+
** defjqiddeaulhb-qwwzwvqmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 311.44
+
** 160.172
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LIPOXYGENASE-RXN]]
+
* [[DALADALALIG-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(13s)-hpode}}
+
{{#set: common-name=d-alanyl-d-alanine}}
{{#set: inchi-key=inchikey=jdsrhvwsamtssn-irqzeampsa-m}}
+
{{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}}
{{#set: molecular-weight=311.44}}
+
{{#set: molecular-weight=160.172}}

Latest revision as of 11:15, 18 March 2021

Metabolite D-ALA-D-ALA

  • common-name:
    • d-alanyl-d-alanine
  • smiles:
    • cc([n+])c(=o)nc(c)c([o-])=o
  • inchi-key:
    • defjqiddeaulhb-qwwzwvqmsa-n
  • molecular-weight:
    • 160.172

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality