Difference between revisions of "D-ALA-D-ALA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GALACTITOL == * common-name: ** galactitol * smiles: ** c(c(c(c(c(o)co)o)o)o)o * inchi-key: ** fbpfztcfmrresa-gucujzijsa-n * molecular-we...") |
(Created page with "Category:metabolite == Metabolite D-ALA-D-ALA == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c)c([o-])=o * inchi-key: ** defjqiddeaulhb-qwwzwvqmsa-n...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-ALA-D-ALA == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-alanyl-d-alanine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+])c(=o)nc(c)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** defjqiddeaulhb-qwwzwvqmsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 160.172 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[DALADALALIG-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-alanyl-d-alanine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=160.172}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite D-ALA-D-ALA
- common-name:
- d-alanyl-d-alanine
- smiles:
- cc([n+])c(=o)nc(c)c([o-])=o
- inchi-key:
- defjqiddeaulhb-qwwzwvqmsa-n
- molecular-weight:
- 160.172
