Difference between revisions of "PHENYLETHYLAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-114 == * common-name: ** all-trans-lycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c * in...") |
(Created page with "Category:metabolite == Metabolite PHENYLETHYLAMINE == * common-name: ** 2-phenylethylamine * smiles: ** c([n+])cc1(=cc=cc=c1) * inchi-key: ** bhhgxplmpwcghp-uhfffaoysa-o *...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHENYLETHYLAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-phenylethylamine |
* smiles: | * smiles: | ||
| − | ** | + | ** c([n+])cc1(=cc=cc=c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bhhgxplmpwcghp-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 122.189 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10817]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-phenylethylamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bhhgxplmpwcghp-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=122.189}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite PHENYLETHYLAMINE
- common-name:
- 2-phenylethylamine
- smiles:
- c([n+])cc1(=cc=cc=c1)
- inchi-key:
- bhhgxplmpwcghp-uhfffaoysa-o
- molecular-weight:
- 122.189
