Difference between revisions of "LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HOMO-CIT == * common-name: ** (2r)-homocitrate * smiles: ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o * inchi-key: ** xkjvevrqmlksmo-ssdotts...")
(Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * smiles: ** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HOMO-CIT ==
+
== Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE ==
 
* common-name:
 
* common-name:
** (2r)-homocitrate
+
** luteolin 7-o-β-d-diglucuronide
 
* smiles:
 
* smiles:
** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
+
** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
 
* inchi-key:
 
* inchi-key:
** xkjvevrqmlksmo-ssdottswsa-k
+
** pbbvwjqpazyqdb-dbfweqbmsa-l
 
* molecular-weight:
 
* molecular-weight:
** 203.128
+
** 636.476
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13722]]
+
* [[RXN-15288]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13722]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r)-homocitrate}}
+
{{#set: common-name=luteolin 7-o-β-d-diglucuronide}}
{{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}}
+
{{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}}
{{#set: molecular-weight=203.128}}
+
{{#set: molecular-weight=636.476}}

Latest revision as of 11:15, 18 March 2021

Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE

  • common-name:
    • luteolin 7-o-β-d-diglucuronide
  • smiles:
    • c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
  • inchi-key:
    • pbbvwjqpazyqdb-dbfweqbmsa-l
  • molecular-weight:
    • 636.476

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality