Difference between revisions of "LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o * inc...")
(Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * smiles: ** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-7417 ==
+
== Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE ==
 
* common-name:
 
* common-name:
−
** cis-coumarinic acid-β-d-glucoside
+
** luteolin 7-o-β-d-diglucuronide
 
* smiles:
 
* smiles:
−
** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
+
** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
 
* inchi-key:
 
* inchi-key:
−
** gvriyimnjgulcz-qlfwqtqqsa-m
+
** pbbvwjqpazyqdb-dbfweqbmsa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 325.294
+
** 636.476
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-8036]]
+
* [[RXN-15288]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=cis-coumarinic acid-β-d-glucoside}}
+
{{#set: common-name=luteolin 7-o-β-d-diglucuronide}}
−
{{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}}
+
{{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}}
−
{{#set: molecular-weight=325.294}}
+
{{#set: molecular-weight=636.476}}

Latest revision as of 11:15, 18 March 2021

Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE

  • common-name:
    • luteolin 7-o-β-d-diglucuronide
  • smiles:
    • c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
  • inchi-key:
    • pbbvwjqpazyqdb-dbfweqbmsa-l
  • molecular-weight:
    • 636.476

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE&oldid=138757"