Difference between revisions of "Protein-With-N-Terminal-X-Pro"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8775 == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inchi-key: ** gpsduzxpycfosq-uhfffaoysa-m * molecular-we...")
(Created page with "Category:metabolite == Metabolite Protein-With-N-Terminal-X-Pro == * common-name: ** a peptide with an n-terminal x-l-proline == Reaction(s) known to consume the compound...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8775 ==
+
== Metabolite Protein-With-N-Terminal-X-Pro ==
 
* common-name:
 
* common-name:
** m-toluate
+
** a peptide with an n-terminal x-l-proline
* smiles:
 
** cc1(=cc(=cc=c1)c(=o)[o-])
 
* inchi-key:
 
** gpsduzxpycfosq-uhfffaoysa-m
 
* molecular-weight:
 
** 135.142
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.4.11.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8583]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=m-toluate}}
+
{{#set: common-name=a peptide with an n-terminal x-l-proline}}
{{#set: inchi-key=inchikey=gpsduzxpycfosq-uhfffaoysa-m}}
 
{{#set: molecular-weight=135.142}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Protein-With-N-Terminal-X-Pro

  • common-name:
    • a peptide with an n-terminal x-l-proline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality