Difference between revisions of "Protein-With-N-Terminal-X-Pro"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8775 == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inchi-key: ** gpsduzxpycfosq-uhfffaoysa-m * molecular-we...") |
(Created page with "Category:metabolite == Metabolite Protein-With-N-Terminal-X-Pro == * common-name: ** a peptide with an n-terminal x-l-proline == Reaction(s) known to consume the compound...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Protein-With-N-Terminal-X-Pro == |
* common-name: | * common-name: | ||
− | ** | + | ** a peptide with an n-terminal x-l-proline |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3.4.11.1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a peptide with an n-terminal x-l-proline}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Protein-With-N-Terminal-X-Pro
- common-name:
- a peptide with an n-terminal x-l-proline