Difference between revisions of "Glycols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7109 == * common-name: ** 4-prenylphlorisovalerophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c * inchi-key: ** lwl...") |
(Created page with "Category:metabolite == Metabolite glycols == * common-name: ** a glycol == Reaction(s) known to consume the compound == * 3.3.2.10-RXN == Reaction(s) known to produce...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite glycols == |
* common-name: | * common-name: | ||
− | ** | + | ** a glycol |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[3.3.2.10-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[3.3.2.10-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a glycol}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite glycols
- common-name:
- a glycol