Difference between revisions of "4-ALPHA-METHYL-5-ALPHA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite P-AMINO-BENZOATE == * common-name: ** 4-aminobenzoate * smiles: ** c(=o)([o-])c1(c=cc(=cc=1)n) * inchi-key: ** alynczndiqevrv-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite 4-ALPHA-METHYL-5-ALPHA == * common-name: ** 4α-methyl-5α-cholest-7-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2([...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-ALPHA-METHYL-5-ALPHA == |
* common-name: | * common-name: | ||
| − | ** 4- | + | ** 4α-methyl-5α-cholest-7-en-3β-ol |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c)cccc([ch]4(c1(c)([ch](c2([ch](cc1)c3(c)([ch](cc=2)c(c)c(o)cc3)))cc4)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lmyzqunlygjihi-sponxpensa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 400.687 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.1.1.270-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.1.1.270-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=4- | + | {{#set: common-name=4α-methyl-5α-cholest-7-en-3β-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lmyzqunlygjihi-sponxpensa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=400.687}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 4-ALPHA-METHYL-5-ALPHA
- common-name:
- 4α-methyl-5α-cholest-7-en-3β-ol
- smiles:
- cc(c)cccc([ch]4(c1(c)([ch](c2([ch](cc1)c3(c)([ch](cc=2)c(c)c(o)cc3)))cc4)))c
- inchi-key:
- lmyzqunlygjihi-sponxpensa-n
- molecular-weight:
- 400.687
