Difference between revisions of "CPD-14053"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13390 == * common-name: ** l-methionyl-l-alanine dipeptide * smiles: ** cc(c(=o)[o-])nc(=o)c(ccsc)[n+] * inchi-key: ** jhkxzylnvjraaj...") |
(Created page with "Category:metabolite == Metabolite CPD-14053 == * common-name: ** (6r)-l-erythro-5,6,7,8-tetrahydrobiopterin * smiles: ** cc(o)c(o)[ch]1(cnc2(n=c(n)nc(c(n1)=2)=o)) * inchi-...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14053 == |
* common-name: | * common-name: | ||
| − | ** l- | + | ** (6r)-l-erythro-5,6,7,8-tetrahydrobiopterin |
* smiles: | * smiles: | ||
| − | ** cc(c( | + | ** cc(o)c(o)[ch]1(cnc2(n=c(n)nc(c(n1)=2)=o)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fnkqxyhwgsifbk-rpdrrwsusa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 241.249 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8853]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=l- | + | {{#set: common-name=(6r)-l-erythro-5,6,7,8-tetrahydrobiopterin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fnkqxyhwgsifbk-rpdrrwsusa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=241.249}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-14053
- common-name:
- (6r)-l-erythro-5,6,7,8-tetrahydrobiopterin
- smiles:
- cc(o)c(o)[ch]1(cnc2(n=c(n)nc(c(n1)=2)=o))
- inchi-key:
- fnkqxyhwgsifbk-rpdrrwsusa-n
- molecular-weight:
- 241.249
