Difference between revisions of "CPD66-23"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+] * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...") |
(Created page with "Category:metabolite == Metabolite CPD66-23 == * common-name: ** 17-α-hydroxypregnenolone * smiles: ** cc(=o)c3(o)(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD66-23 == |
* common-name: | * common-name: | ||
− | ** | + | ** 17-α-hydroxypregnenolone |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=o)c3(o)(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** jergucijoxjxhf-tvwvxwensa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 332.482 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-350]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-350]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=17-α-hydroxypregnenolone}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jergucijoxjxhf-tvwvxwensa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=332.482}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD66-23
- common-name:
- 17-α-hydroxypregnenolone
- smiles:
- cc(=o)c3(o)(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- jergucijoxjxhf-tvwvxwensa-n
- molecular-weight:
- 332.482