Difference between revisions of "MALONATE-S-ALD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HOMO-CIS-ACONITATE == * common-name: ** cis-homoaconitate * smiles: ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] * inchi-key: ** bjypzfuwwjsak...") |
(Created page with "Category:metabolite == Metabolite MALONATE-S-ALD == * common-name: ** 3-oxopropanoate * smiles: ** [ch](=o)cc([o-])=o * inchi-key: ** oakurxizzoaybc-uhfffaoysa-m * molecul...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MALONATE-S-ALD == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxopropanoate |
* smiles: | * smiles: | ||
− | ** | + | ** [ch](=o)cc([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oakurxizzoaybc-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 87.055 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.2.1.18-RXN]] |
+ | * [[RXN-2901]] | ||
+ | * [[RXN-2902]] | ||
+ | * [[RXN-9958]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.2.1.18-RXN]] |
+ | * [[RXN-16322]] | ||
+ | * [[RXN-2901]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxopropanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oakurxizzoaybc-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=87.055}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite MALONATE-S-ALD
- common-name:
- 3-oxopropanoate
- smiles:
- [ch](=o)cc([o-])=o
- inchi-key:
- oakurxizzoaybc-uhfffaoysa-m
- molecular-weight:
- 87.055