Difference between revisions of "CPD-10277"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytosine2278-in-25S-rRNA == * common-name: ** a cytosine2278 in 25s rrna == Reaction(s) known to consume the compound == * RXN-15844...") |
(Created page with "Category:metabolite == Metabolite CPD-10277 == * common-name: ** lotaustralin * smiles: ** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c * inchi-key: ** wewbwvmtoyuphh-qhaqebjbsa-n...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-10277 == |
* common-name: | * common-name: | ||
− | ** | + | ** lotaustralin |
+ | * smiles: | ||
+ | ** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c | ||
+ | * inchi-key: | ||
+ | ** wewbwvmtoyuphh-qhaqebjbsa-n | ||
+ | * molecular-weight: | ||
+ | ** 261.274 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-9674]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-13603]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=lotaustralin}} |
+ | {{#set: inchi-key=inchikey=wewbwvmtoyuphh-qhaqebjbsa-n}} | ||
+ | {{#set: molecular-weight=261.274}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-10277
- common-name:
- lotaustralin
- smiles:
- ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c
- inchi-key:
- wewbwvmtoyuphh-qhaqebjbsa-n
- molecular-weight:
- 261.274