Difference between revisions of "BUTYRYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8340 RXN-8340] == * direction: ** left-to-right * common-name: ** gtp 3',8'-cyclase * ec-number...")
 
(Created page with "Category:metabolite == Metabolite BUTYRYL-COA == * common-name: ** butanoyl-coa * smiles: ** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8340 RXN-8340] ==
+
== Metabolite BUTYRYL-COA ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** gtp 3',8'-cyclase
+
** butanoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.99.22 ec-4.1.99.22]
+
** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Donor-H2]][c] '''+''' 1 [[GTP]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[Acceptor]][c] '''+''' 1 [[CH33ADO]][c] '''+''' 1 [[CPD-19179]][c] '''+''' 1 [[MET]][c] '''+''' 1 [[PROTON]][c]
+
** crfngmnykdxrtn-hdrjhvaisa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17375]]
+
** 833.593
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ACACT2h]]
−
* Gene: [[SJ16278]]
+
* [[ACOA40OR]]
−
** Category: [[annotation]]
+
* [[ACOAD1f]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-12565]]
−
** Category: [[orthology]]
+
* [[RXN-13029]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[ACOAD1f]]
−
* [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823]
+
* [[ACOAR1h]]
−
** '''7''' reactions found over '''8''' reactions in the full pathway
+
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
−
== Reconstruction information  ==
+
* [[RXN-12558]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13029]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=butanoyl-coa}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=crfngmnykdxrtn-hdrjhvaisa-j}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26378 26378]
+
{{#set: molecular-weight=833.593}}
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R09394 R09394]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=gtp 3',8'-cyclase}}
 
−
{{#set: ec-number=ec-4.1.99.22}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite BUTYRYL-COA

  • common-name:
    • butanoyl-coa
  • smiles:
    • cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • crfngmnykdxrtn-hdrjhvaisa-j
  • molecular-weight:
    • 833.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=BUTYRYL-COA&oldid=139080"