Difference between revisions of "18S-rRNA-N1-methylpseudouridine-1191"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12126 == * common-name: ** menaquinol-9 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(...")
(Created page with "Category:metabolite == Metabolite 18S-rRNA-N1-methylpseudouridine-1191 == * common-name: ** an 18s rrna n1-methylpseudouridine1191 == Reaction(s) known to consume the comp...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12126 ==
+
== Metabolite 18S-rRNA-N1-methylpseudouridine-1191 ==
 
* common-name:
 
* common-name:
** menaquinol-9
+
** an 18s rrna n1-methylpseudouridine1191
* smiles:
 
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 
* inchi-key:
 
** knwzipkbogoffc-uvzvdvbnsa-n
 
* molecular-weight:
 
** 787.263
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9205]]
+
* [[RXN-13327]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-9}}
+
{{#set: common-name=an 18s rrna n1-methylpseudouridine1191}}
{{#set: inchi-key=inchikey=knwzipkbogoffc-uvzvdvbnsa-n}}
 
{{#set: molecular-weight=787.263}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 18S-rRNA-N1-methylpseudouridine-1191

  • common-name:
    • an 18s rrna n1-methylpseudouridine1191

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality