Difference between revisions of "CPD-4207"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate == * common-name: ** a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to con...") |
(Created page with "Category:metabolite == Metabolite CPD-4207 == * common-name: ** isopentenyl adenosine * smiles: ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) * inchi-key: ** usvm...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-4207 == |
* common-name: | * common-name: | ||
− | ** | + | ** isopentenyl adenosine |
+ | * smiles: | ||
+ | ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) | ||
+ | * inchi-key: | ||
+ | ** usvmjsalorzvdv-sdbhatresa-n | ||
+ | * molecular-weight: | ||
+ | ** 335.362 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-4315]] | ||
+ | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] | ||
+ | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-4315]] |
+ | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] | ||
+ | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=isopentenyl adenosine}} |
+ | {{#set: inchi-key=inchikey=usvmjsalorzvdv-sdbhatresa-n}} | ||
+ | {{#set: molecular-weight=335.362}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-4207
- common-name:
- isopentenyl adenosine
- smiles:
- cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
- inchi-key:
- usvmjsalorzvdv-sdbhatresa-n
- molecular-weight:
- 335.362
Reaction(s) known to consume the compound
- RXN-4315
- RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.
- RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.
Reaction(s) known to produce the compound
- RXN-4315
- RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.
- RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.