Difference between revisions of "M7G5-pppR-mRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OXALO-SUCCINATE == * common-name: ** oxalosuccinate * smiles: ** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o * inchi-key: ** ufscuaxltrfidc-uh...") |
(Created page with "Category:metabolite == Metabolite m7G5-pppR-mRNAs == * common-name: ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna] == Reaction(s) known to consu...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite m7G5-pppR-mRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[2.1.1.57-RXN]] |
− | * [[RXN- | + | * [[RXN-12817]] |
+ | * [[RXN-12826]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]] |
− | * [[RXN- | + | * [[RXN-12817]] |
+ | * [[RXN-12826]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna]}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite m7G5-pppR-mRNAs
- common-name:
- a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-(n7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.