Difference between revisions of "CPD-5168"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11674 == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) * inchi-key: ** focuaj...") |
(Created page with "Category:metabolite == Metabolite CPD-5168 == * common-name: ** α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-&alpha...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-5168 == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-5470]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-5469]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-5168
- common-name:
- α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.