Difference between revisions of "Bleomycins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1308 == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o * inchi-key: ** xddaorkbjwwyjs-uhfffaoysa-l * molecular...") |
(Created page with "Category:metabolite == Metabolite Bleomycins == * common-name: ** a bleomycin == Reaction(s) known to consume the compound == * 3.4.22.40-RXN == Reaction(s) known to p...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Bleomycins == |
* common-name: | * common-name: | ||
− | ** | + | ** a bleomycin |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[3.4.22.40-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a bleomycin}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Bleomycins
- common-name:
- a bleomycin