Difference between revisions of "GLC"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA == * common-name: ** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)...") |
(Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-vfuothlcsa-n * mol...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLC == |
* common-name: | * common-name: | ||
− | ** | + | ** β-d-glucopyranose |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)c1(oc(o)c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wqzgkkkjijffok-vfuothlcsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[1 | + | * [[ALDOSE-1-EPIMERASE-RXN]] |
− | * [[ | + | * [[GLUCISOM-RXN-GLC//CPD-15382.15.]] |
− | * [[ | + | * [[biomass_rxn]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.2.1.106-RXN]] |
− | * [[ | + | * [[ALDOSE-1-EPIMERASE-RXN]] |
− | * [[ | + | * [[GLUCISOM-RXN-GLC//CPD-15382.15.]] |
− | * [[ | + | * [[TREHALA-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=β-d-glucopyranose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-vfuothlcsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite GLC
- common-name:
- β-d-glucopyranose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-vfuothlcsa-n
- molecular-weight:
- 180.157