Difference between revisions of "CPD-36"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ETHANOLAMINEPHOSPHOTRANSFERASE-RXN ETHANOLAMINEPHOSPHOTRANSFERASE-RXN] == * direction: ** left-to-r...") |
(Created page with "Category:metabolite == Metabolite CPD-36 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine * smiles: ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-36 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine |
− | + | * smiles: | |
− | * | + | ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) |
− | ** | + | * inchi-key: |
− | = | + | ** dlgjwsvwtwewbj-ztvljyeesa-m |
− | + | * molecular-weight: | |
− | == | + | ** 378.312 |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-12178]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine}} | |
− | ** | + | {{#set: inchi-key=inchikey=dlgjwsvwtwewbj-ztvljyeesa-m}} |
− | == | + | {{#set: molecular-weight=378.312}} |
− | * [[ | ||
− | |||
− | == | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-36
- common-name:
- 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine
- smiles:
- cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
- inchi-key:
- dlgjwsvwtwewbj-ztvljyeesa-m
- molecular-weight:
- 378.312