Difference between revisions of "CPD-36"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ETHANOLAMINEPHOSPHOTRANSFERASE-RXN ETHANOLAMINEPHOSPHOTRANSFERASE-RXN] == * direction: ** left-to-r...")
 
(Created page with "Category:metabolite == Metabolite CPD-36 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine * smiles: ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ETHANOLAMINEPHOSPHOTRANSFERASE-RXN ETHANOLAMINEPHOSPHOTRANSFERASE-RXN] ==
+
== Metabolite CPD-36 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** ethanolaminephosphotransferase
+
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine
** 1,2-diacyl-sn-glycerol ethanolaminephosphotransferase
+
* smiles:
* ec-number:
+
** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
** [http://enzyme.expasy.org/EC/2.7.8.1 ec-2.7.8.1]
+
* inchi-key:
== Reaction formula ==
+
** dlgjwsvwtwewbj-ztvljyeesa-m
* 1 [[CDP-ETHANOLAMINE]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''=>''' 1 [[CMP]][c] '''+''' 1 [[L-1-PHOSPHATIDYL-ETHANOLAMINE]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 378.312
* Gene: [[SJ19317]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[RXN-12178]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ16464]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: inchi-key=inchikey=dlgjwsvwtwewbj-ztvljyeesa-m}}
== Pathway(s) ==
+
{{#set: molecular-weight=378.312}}
* [[PWY4FS-6]], phosphatidylethanolamine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-6 PWY4FS-6]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14593 14593]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R02057 R02057]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P22140 P22140]
 
** [http://www.uniprot.org/uniprot/Q39810 Q39810]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=1,2-diacyl-sn-glycerol ethanolaminephosphotransferase|ethanolaminephosphotransferase}}
 
{{#set: ec-number=ec-2.7.8.1}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-36

  • common-name:
    • 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine
  • smiles:
    • cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
  • inchi-key:
    • dlgjwsvwtwewbj-ztvljyeesa-m
  • molecular-weight:
    • 378.312

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality