Difference between revisions of "CPD-17539"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-415 == * common-name: ** a 1-long-chain acyl-glycerone 3-phosphate == Reaction(s) known to consume the compound == * ALKYLGLYCERONE...") |
(Created page with "Category:metabolite == Metabolite CPD-17539 == * common-name: ** dapdiamide a * smiles: ** cc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** jagleobxishnnm-br...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-17539 == |
* common-name: | * common-name: | ||
| − | ** a | + | ** dapdiamide a |
| + | * smiles: | ||
| + | ** cc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o | ||
| + | * inchi-key: | ||
| + | ** jagleobxishnnm-bruqvklwsa-n | ||
| + | * molecular-weight: | ||
| + | ** 300.314 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16291]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=a | + | {{#set: common-name=dapdiamide a}} |
| + | {{#set: inchi-key=inchikey=jagleobxishnnm-bruqvklwsa-n}} | ||
| + | {{#set: molecular-weight=300.314}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-17539
- common-name:
- dapdiamide a
- smiles:
- cc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
- inchi-key:
- jagleobxishnnm-bruqvklwsa-n
- molecular-weight:
- 300.314
