Difference between revisions of "CPD-8092"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3b-hydroxy-D5-steroids == * common-name: ** a 3β-hydroxy-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1....")
(Created page with "Category:metabolite == Metabolite CPD-8092 == * common-name: ** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=c...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3b-hydroxy-D5-steroids ==
+
== Metabolite CPD-8092 ==
 
* common-name:
 
* common-name:
** a 3β-hydroxy-δ5-steroid
+
** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine
 +
* smiles:
 +
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 +
* inchi-key:
 +
** fvqgnfubhwgfcy-hjoyqdmmsa-n
 +
* molecular-weight:
 +
** 782.092
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.145-RXN]]
+
* [[RXN-8324]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.145-RXN]]
+
* [[RXN-8326]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3β-hydroxy-δ5-steroid}}
+
{{#set: common-name=1-oleoyl-2-α-linolenoyl-phosphatidylcholine}}
 +
{{#set: inchi-key=inchikey=fvqgnfubhwgfcy-hjoyqdmmsa-n}}
 +
{{#set: molecular-weight=782.092}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-8092

  • common-name:
    • 1-oleoyl-2-α-linolenoyl-phosphatidylcholine
  • smiles:
    • ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • fvqgnfubhwgfcy-hjoyqdmmsa-n
  • molecular-weight:
    • 782.092

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality