Difference between revisions of "CPD-8092"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UREA == * common-name: ** urea * smiles: ** c(=o)(n)n * inchi-key: ** xsqukjjjfzcrtk-uhfffaoysa-n * molecular-weight: ** 60.055 == Reacti...")
(Created page with "Category:metabolite == Metabolite CPD-8092 == * common-name: ** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=c...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UREA ==
+
== Metabolite CPD-8092 ==
 
* common-name:
 
* common-name:
** urea
+
** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine
 
* smiles:
 
* smiles:
** c(=o)(n)n
+
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
* inchi-key:
** xsqukjjjfzcrtk-uhfffaoysa-n
+
** fvqgnfubhwgfcy-hjoyqdmmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 60.055
+
** 782.092
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARGINASE-RXN]]
+
* [[RXN-8324]]
* [[TRANS-RXN0-460]]
 
* [[UREASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AGMATIN-RXN]]
+
* [[RXN-8326]]
* [[ALLANTOICASE-RXN]]
 
* [[ARGINASE-RXN]]
 
* [[CREATINASE-RXN]]
 
* [[RXN-34]]
 
* [[TRANS-RXN0-460]]
 
* [[UREASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=urea}}
+
{{#set: common-name=1-oleoyl-2-α-linolenoyl-phosphatidylcholine}}
{{#set: inchi-key=inchikey=xsqukjjjfzcrtk-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=fvqgnfubhwgfcy-hjoyqdmmsa-n}}
{{#set: molecular-weight=60.055}}
+
{{#set: molecular-weight=782.092}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-8092

  • common-name:
    • 1-oleoyl-2-α-linolenoyl-phosphatidylcholine
  • smiles:
    • ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • fvqgnfubhwgfcy-hjoyqdmmsa-n
  • molecular-weight:
    • 782.092

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality