Difference between revisions of "CPD0-2184"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15972 == * common-name: ** lactose == Reaction(s) known to consume the compound == * BETAGALACTOSID-RXN == Reaction(s) known to p...") |
(Created page with "Category:metabolite == Metabolite CPD0-2184 == * common-name: ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate * smiles: ** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2184 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate |
+ | * smiles: | ||
+ | ** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o | ||
+ | * inchi-key: | ||
+ | ** wcjyzufkktynlb-aritwgjrsa-l | ||
+ | * molecular-weight: | ||
+ | ** 210.143 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12070]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}} |
+ | {{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}} | ||
+ | {{#set: molecular-weight=210.143}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD0-2184
- common-name:
- (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
- smiles:
- c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
- inchi-key:
- wcjyzufkktynlb-aritwgjrsa-l
- molecular-weight:
- 210.143