Difference between revisions of "GUANOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Glycerol-1-phosphate == * common-name: ** glycerol 1-phosphate == Reaction(s) known to consume the compound == * GLYCEROL-1-PHOSPHATASE...") |
(Created page with "Category:metabolite == Metabolite GUANOSINE == * common-name: ** guanosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** nyhbqmygnkiuif-uuo...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GUANOSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** guanosine |
+ | * smiles: | ||
+ | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) | ||
+ | * inchi-key: | ||
+ | ** nyhbqmygnkiuif-uuokfmhzsa-n | ||
+ | * molecular-weight: | ||
+ | ** 283.243 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-366]] |
+ | * [[RXN0-5199]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7609]] | ||
+ | * [[RXN0-5199]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=guanosine}} |
+ | {{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}} | ||
+ | {{#set: molecular-weight=283.243}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite GUANOSINE
- common-name:
- guanosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- nyhbqmygnkiuif-uuokfmhzsa-n
- molecular-weight:
- 283.243