Difference between revisions of "PWY-5288"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-PALMITOYLGLYCEROL-3-PHOSPHATE 1-PALMITOYLGLYCEROL-3-PHOSPHATE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE SUCROSE] ==
 * common-name:
-** 1-palmitoylglycerol 3-phosphate
+** sucrose
 * smiles:
-** cccccccccccccccc(=o)occ(o)cop(=o)([o-])[o-]
+** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o
 * inchi-key:
-** yndykprnfwppfu-gosisdbhsa-l
+** czmrcdwagmrecn-ugdnzrgbsa-n
 * molecular-weight:
-** 408.471
+** 342.299
 == Reaction(s) known to consume the compound ==
-* [[RXN-17008]]
+* [[2.4.1.82-RXN]]
-* [[RXN-17010]]
-* [[RXN-17012]]
-* [[RXN-17014]]
-* [[RXN-17023]]
-* [[RXN-17024]]
-* [[RXN0-6705]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17018]]
+* [[RXN-11502]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-palmitoylglycerol 3-phosphate}}
+{{#set: common-name=sucrose}}
-{{#set: inchi-key=inchikey=yndykprnfwppfu-gosisdbhsa-l}}
+{{#set: inchi-key=inchikey=czmrcdwagmrecn-ugdnzrgbsa-n}}
-{{#set: molecular-weight=408.471}}
+{{#set: molecular-weight=342.299}}