Difference between revisions of "CPD-9957"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** xgyimtfotbmpfp-kqy...") |
(Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9957 == |
* common-name: | * common-name: | ||
− | ** | + | ** ubiquinol-9 |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** npcoqxavbjjzbq-wjnluyjisa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 797.255 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[2. | + | * [[2.1.1.64-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ubiquinol-9}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=797.255}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-9957
- common-name:
- ubiquinol-9
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
- inchi-key:
- npcoqxavbjjzbq-wjnluyjisa-n
- molecular-weight:
- 797.255